C9H13NO4 — CID 19898238
methyl 6,6-dimethyl-2,4-dioxopiperidine-3-carboxylate (PubChem CID 19898238) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is methyl 6,6-dimethyl-2,4-dioxopiperidine-3-carboxylate.
| Compound Name | methyl 6,6-dimethyl-2,4-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 19898238 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | methyl 6,6-dimethyl-2,4-dioxopiperidine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)CC(C)(C)NC1=O |
| InChI | InChI=1S/C9H13NO4/c1-9(2)4-5(11)6(7(12)10-9)8(13)14-3/h6H,4H2,1-3H3,(H,10,12) |
| InChIKey | FCXDIYVVOCFIMV-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|