C9H16ClNO3 — CID 169448857
methyl 6,6-dimethyl-4-oxopiperidine-3-carboxylate;hydrochloride (PubChem CID 169448857) has the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. Its IUPAC name is methyl 6,6-dimethyl-4-oxopiperidine-3-carboxylate;hydrochloride.
| Compound Name | methyl 6,6-dimethyl-4-oxopiperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 169448857 |
| Molecular Formula | C9H16ClNO3 |
| Molecular Weight | 221.68 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | methyl 6,6-dimethyl-4-oxopiperidine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CNC(C)(C)CC1=O.Cl |
| InChI | InChI=1S/C9H15NO3.ClH/c1-9(2)4-7(11)6(5-10-9)8(12)13-3;/h6,10H,4-5H2,1-3H3;1H |
| InChIKey | KYKXQMWPYPKJPT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.68 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|