About methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate
methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate (PubChem CID 131560848) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate |
| PubChem CID | 131560848 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate |
| SMILES | COC(=O)CC1CNC(C)(C)C1 |
| InChI | InChI=1S/C9H17NO2/c1-9(2)5-7(6-10-9)4-8(11)12-3/h7,10H,4-6H2,1-3H3 |
| InChIKey | WOESJWFDJOTIPM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate?
The IUPAC name of methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate (CID 131560848) is methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate.
What is the SMILES notation for methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate?
The canonical SMILES for methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate is COC(=O)CC1CNC(C)(C)C1.
What is the InChIKey of methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate?
The InChIKey is WOESJWFDJOTIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-9(2)5-7(6-10-9)4-8(11)12-3/h7,10H,4-6H2,1-3H3.
What are the key properties of methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate?
methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate has a molecular weight of 171.24 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5,5-dimethylpyrrolidin-3-yl)acetate is sourced from PubChem (CID 131560848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).