C7H14N2O — CID 129142107
(3S)-5,5-dimethylpyrrolidine-3-carboxamide (PubChem CID 129142107) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (3S)-5,5-dimethylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-5,5-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 129142107 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (3S)-5,5-dimethylpyrrolidine-3-carboxamide |
| SMILES | CC1(C)C[C@H](C(N)=O)CN1 |
| InChI | InChI=1S/C7H14N2O/c1-7(2)3-5(4-9-7)6(8)10/h5,9H,3-4H2,1-2H3,(H2,8,10)/t5-/m0/s1 |
| InChIKey | WDHYSRZOUINPNI-YFKPBYRVSA-N |
| XLogP | -0.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |