C21H26N2O2 — CID 166354961
N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-5,5-dimethylpyrrolidine-3-carboxamide (PubChem CID 166354961) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-5,5-dimethylpyrrolidine-3-carboxamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-5,5-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166354961 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-5,5-dimethylpyrrolidine-3-carboxamide |
| SMILES | CC1(C)CC(C(=O)N[C@@H](c2ccccc2)[C@H](O)c2ccccc2)CN1 |
| InChI | InChI=1S/C21H26N2O2/c1-21(2)13-17(14-22-21)20(25)23-18(15-9-5-3-6-10-15)19(24)16-11-7-4-8-12-16/h3-12,17-19,22,24H,13-14H2,1-2H3,(H,23,25)/t17?,18-,19+/m0/s1 |
| InChIKey | JUFMZLFHXMQZMU-JLMCIHFGSA-N |
| XLogP | 2.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |