About [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea
[(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea (PubChem CID 11097193) has the molecular formula C15H16N2O2
and a molecular weight of 256.31 g/mol. Its IUPAC name is [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea.
Molecular Properties
| Compound Name | [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea |
| PubChem CID | 11097193 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea |
| SMILES | NC(=O)N[C@H](c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O2/c16-15(19)17-13(11-7-3-1-4-8-11)14(18)12-9-5-2-6-10-12/h1-10,13-14,18H,(H3,16,17,19)/t13-,14+/m1/s1 |
| InChIKey | NTOVGLTWEWWNIX-KGLIPLIRSA-N |
| XLogP | 2.13 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea?
The IUPAC name of [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea (CID 11097193) is [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea.
What is the SMILES notation for [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea?
The canonical SMILES for [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea is NC(=O)N[C@H](c1ccccc1)[C@@H](O)c1ccccc1.
What is the InChIKey of [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea?
The InChIKey is NTOVGLTWEWWNIX-KGLIPLIRSA-N. The full InChI is InChI=1S/C15H16N2O2/c16-15(19)17-13(11-7-3-1-4-8-11)14(18)12-9-5-2-6-10-12/h1-10,13-14,18H,(H3,16,17,19)/t13-,14+/m1/s1.
What are the key properties of [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea?
[(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea has a molecular weight of 256.31 g/mol, XLogP of 2.13, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-hydroxy-1,2-diphenylethyl]urea is sourced from PubChem (CID 11097193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).