C35H31N3O4 — CID 171379474
2-N,6-N-bis[(1S,2R)-2-hydroxy-1,2-diphenylethyl]pyridine-2,6-dicarboxamide (PubChem CID 171379474) has the molecular formula C35H31N3O4 and a molecular weight of 557.65 g/mol. Its IUPAC name is 2-N,6-N-bis[(1S,2R)-2-hydroxy-1,2-diphenylethyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[(1S,2R)-2-hydroxy-1,2-diphenylethyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 171379474 |
| Molecular Formula | C35H31N3O4 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 2-N,6-N-bis[(1S,2R)-2-hydroxy-1,2-diphenylethyl]pyridine-2,6-dicarboxamide |
| SMILES | O=C(N[C@@H](c1ccccc1)[C@H](O)c1ccccc1)c1cccc(C(=O)N[C@@H](c2ccccc2)[C@H](O)c2ccccc2)n1 |
| InChI | InChI=1S/C35H31N3O4/c39-32(26-18-9-3-10-19-26)30(24-14-5-1-6-15-24)37-34(41)28-22-13-23-29(36-28)35(42)38-31(25-16-7-2-8-17-25)33(40)27-20-11-4-12-21-27/h1-23,30-33,39-40H,(H,37,41)(H,38,42)/t30-,31-,32+,33+/m0/s1 |
| InChIKey | UCXZYZIJIGAQHP-UYEZAFAQSA-N |
| XLogP | 5.49 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |