C46H46N6O4 — CID 139136791
2-N-[(1S)-1-phenylethyl]-6-N-[(1R)-1-phenylethyl]pyridine-2,6-dicarboxamide (PubChem CID 139136791) has the molecular formula C46H46N6O4 and a molecular weight of 746.91 g/mol. Its IUPAC name is 2-N-[(1S)-1-phenylethyl]-6-N-[(1R)-1-phenylethyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[(1S)-1-phenylethyl]-6-N-[(1R)-1-phenylethyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 139136791 |
| Molecular Formula | C46H46N6O4 |
| Molecular Weight | 746.91 g/mol |
| Exact Mass | 746.36 |
| IUPAC Name | 2-N-[(1S)-1-phenylethyl]-6-N-[(1R)-1-phenylethyl]pyridine-2,6-dicarboxamide |
| SMILES | C[C@H](NC(=O)c1cccc(C(=O)N[C@H](C)c2ccccc2)n1)c1ccccc1.C[C@H](NC(=O)c1cccc(C(=O)N[C@H](C)c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/2C23H23N3O2/c2*1-16(18-10-5-3-6-11-18)24-22(27)20-14-9-15-21(26-20)23(28)25-17(2)19-12-7-4-8-13-19/h2*3-17H,1-2H3,(H,24,27)(H,25,28)/t2*16-,17+ |
| InChIKey | BDIOFFWSJIFNSE-CNGQEUITSA-N |
| XLogP | 8.13 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.91 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |