C23H21F2N3O2 — CID 46430353
2-N,6-N-bis[1-(4-fluorophenyl)ethyl]pyridine-2,6-dicarboxamide (PubChem CID 46430353) has the molecular formula C23H21F2N3O2 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-N,6-N-bis[1-(4-fluorophenyl)ethyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[1-(4-fluorophenyl)ethyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 46430353 |
| Molecular Formula | C23H21F2N3O2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-N,6-N-bis[1-(4-fluorophenyl)ethyl]pyridine-2,6-dicarboxamide |
| SMILES | CC(NC(=O)c1cccc(C(=O)NC(C)c2ccc(F)cc2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21F2N3O2/c1-14(16-6-10-18(24)11-7-16)26-22(29)20-4-3-5-21(28-20)23(30)27-15(2)17-8-12-19(25)13-9-17/h3-15H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | HJUQUQUYIMXAOI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |