C20H23N3O2 — CID 109094954
2-N-cyclopentyl-6-N-(1-phenylethyl)pyridine-2,6-dicarboxamide (PubChem CID 109094954) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-N-cyclopentyl-6-N-(1-phenylethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-cyclopentyl-6-N-(1-phenylethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094954 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-N-cyclopentyl-6-N-(1-phenylethyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(NC(=O)c1cccc(C(=O)NC2CCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-14(15-8-3-2-4-9-15)21-19(24)17-12-7-13-18(23-17)20(25)22-16-10-5-6-11-16/h2-4,7-9,12-14,16H,5-6,10-11H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | RMKBZYVVIRZAGA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |