C13H19N3O6 — CID 22457897
2-N,6-N-bis(1,3-dihydroxypropyl)pyridine-2,6-dicarboxamide (PubChem CID 22457897) has the molecular formula C13H19N3O6 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-N,6-N-bis(1,3-dihydroxypropyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(1,3-dihydroxypropyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 22457897 |
| Molecular Formula | C13H19N3O6 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-N,6-N-bis(1,3-dihydroxypropyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NC(O)CCO)c1cccc(C(=O)NC(O)CCO)n1 |
| InChI | InChI=1S/C13H19N3O6/c17-6-4-10(19)15-12(21)8-2-1-3-9(14-8)13(22)16-11(20)5-7-18/h1-3,10-11,17-20H,4-7H2,(H,15,21)(H,16,22) |
| InChIKey | UBFVJVBOSJPCQR-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|