C15H27N7O2 — CID 102285423
2-N,6-N-bis(3,4-diaminobutyl)pyridine-2,6-dicarboxamide (PubChem CID 102285423) has the molecular formula C15H27N7O2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-N,6-N-bis(3,4-diaminobutyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(3,4-diaminobutyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 102285423 |
| Molecular Formula | C15H27N7O2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 2-N,6-N-bis(3,4-diaminobutyl)pyridine-2,6-dicarboxamide |
| SMILES | NCC(N)CCNC(=O)c1cccc(C(=O)NCCC(N)CN)n1 |
| InChI | InChI=1S/C15H27N7O2/c16-8-10(18)4-6-20-14(23)12-2-1-3-13(22-12)15(24)21-7-5-11(19)9-17/h1-3,10-11H,4-9,16-19H2,(H,20,23)(H,21,24) |
| InChIKey | FGLUNOYFNODMAL-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 175.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |