C6H15ClN2O2S — CID 146150570
5,5-dimethylpyrrolidine-3-sulfonamide;hydrochloride (PubChem CID 146150570) has the molecular formula C6H15ClN2O2S and a molecular weight of 214.72 g/mol. Its IUPAC name is 5,5-dimethylpyrrolidine-3-sulfonamide;hydrochloride.
| Compound Name | 5,5-dimethylpyrrolidine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 146150570 |
| Molecular Formula | C6H15ClN2O2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 5,5-dimethylpyrrolidine-3-sulfonamide;hydrochloride |
| SMILES | CC1(C)CC(S(N)(=O)=O)CN1.Cl |
| InChI | InChI=1S/C6H14N2O2S.ClH/c1-6(2)3-5(4-8-6)11(7,9)10;/h5,8H,3-4H2,1-2H3,(H2,7,9,10);1H |
| InChIKey | MDWOKDPNUWABJA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |