C7H13NO — CID 141296159
(3S)-5,5-dimethylpyrrolidine-3-carbaldehyde (PubChem CID 141296159) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (3S)-5,5-dimethylpyrrolidine-3-carbaldehyde.
| Compound Name | (3S)-5,5-dimethylpyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 141296159 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (3S)-5,5-dimethylpyrrolidine-3-carbaldehyde |
| SMILES | CC1(C)C[C@H](C=O)CN1 |
| InChI | InChI=1S/C7H13NO/c1-7(2)3-6(5-9)4-8-7/h5-6,8H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | FZFMZKUCYXCFHP-LURJTMIESA-N |
| XLogP | 0.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|