C8H13F3N2O — CID 174576382
5,5-dimethyl-1-(trifluoromethyl)piperazine-2-carbaldehyde (PubChem CID 174576382) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is 5,5-dimethyl-1-(trifluoromethyl)piperazine-2-carbaldehyde.
| Compound Name | 5,5-dimethyl-1-(trifluoromethyl)piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174576382 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5,5-dimethyl-1-(trifluoromethyl)piperazine-2-carbaldehyde |
| SMILES | CC1(C)CN(C(F)(F)F)C(C=O)CN1 |
| InChI | InChI=1S/C8H13F3N2O/c1-7(2)5-13(8(9,10)11)6(4-14)3-12-7/h4,6,12H,3,5H2,1-2H3 |
| InChIKey | FTUFDIMPMVKHBS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|