C7H11F3N2O — CID 174862765
1-(1,2,2-trifluoroethyl)piperazine-2-carbaldehyde (PubChem CID 174862765) has the molecular formula C7H11F3N2O and a molecular weight of 196.17 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethyl)piperazine-2-carbaldehyde.
| Compound Name | 1-(1,2,2-trifluoroethyl)piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174862765 |
| Molecular Formula | C7H11F3N2O |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-(1,2,2-trifluoroethyl)piperazine-2-carbaldehyde |
| SMILES | O=CC1CNCCN1C(F)C(F)F |
| InChI | InChI=1S/C7H11F3N2O/c8-6(9)7(10)12-2-1-11-3-5(12)4-13/h4-7,11H,1-3H2 |
| InChIKey | HOGGLZMTXIFDRS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|