C7H9F3N2O2 — CID 166752838
(2R)-1-(2,2,2-trifluoroacetyl)piperazine-2-carbaldehyde (PubChem CID 166752838) has the molecular formula C7H9F3N2O2 and a molecular weight of 210.15 g/mol. Its IUPAC name is (2R)-1-(2,2,2-trifluoroacetyl)piperazine-2-carbaldehyde.
| Compound Name | (2R)-1-(2,2,2-trifluoroacetyl)piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 166752838 |
| Molecular Formula | C7H9F3N2O2 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (2R)-1-(2,2,2-trifluoroacetyl)piperazine-2-carbaldehyde |
| SMILES | O=C[C@H]1CNCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2O2/c8-7(9,10)6(14)12-2-1-11-3-5(12)4-13/h4-5,11H,1-3H2/t5-/m1/s1 |
| InChIKey | ZLVWZPLGKUGAFV-RXMQYKEDSA-N |
| XLogP | -0.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|