C7H14N2O — CID 174601617
6,6-dimethylpiperazine-2-carbaldehyde (PubChem CID 174601617) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 6,6-dimethylpiperazine-2-carbaldehyde.
| Compound Name | 6,6-dimethylpiperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174601617 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 6,6-dimethylpiperazine-2-carbaldehyde |
| SMILES | CC1(C)CNCC(C=O)N1 |
| InChI | InChI=1S/C7H14N2O/c1-7(2)5-8-3-6(4-10)9-7/h4,6,8-9H,3,5H2,1-2H3 |
| InChIKey | DROHNIJUNFBOAB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|