C12H18N2O — CID 82395867
2-(6,6-dimethylpiperazin-2-yl)phenol (PubChem CID 82395867) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(6,6-dimethylpiperazin-2-yl)phenol.
| Compound Name | 2-(6,6-dimethylpiperazin-2-yl)phenol |
|---|---|
| PubChem CID | 82395867 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(6,6-dimethylpiperazin-2-yl)phenol |
| SMILES | CC1(C)CNCC(c2ccccc2O)N1 |
| InChI | InChI=1S/C12H18N2O/c1-12(2)8-13-7-10(14-12)9-5-3-4-6-11(9)15/h3-6,10,13-15H,7-8H2,1-2H3 |
| InChIKey | QWVSDRGLDFUFPL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|