C12H16FN — CID 124671045
(4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine (PubChem CID 124671045) has the molecular formula C12H16FN and a molecular weight of 193.27 g/mol. Its IUPAC name is (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine.
| Compound Name | (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 124671045 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine |
| SMILES | CC1(C)CNC[C@H]1c1ccccc1F |
| InChI | InChI=1S/C12H16FN/c1-12(2)8-14-7-10(12)9-5-3-4-6-11(9)13/h3-6,10,14H,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | FLZGNBLMORKILV-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |