About (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine
(4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine (PubChem CID 124671045) has the molecular formula C12H16FN
and a molecular weight of 193.27 g/mol. Its IUPAC name is (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine |
| PubChem CID | 124671045 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine |
| SMILES | CC1(C)CNC[C@H]1c1ccccc1F |
| InChI | InChI=1S/C12H16FN/c1-12(2)8-14-7-10(12)9-5-3-4-6-11(9)13/h3-6,10,14H,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | FLZGNBLMORKILV-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine?
The IUPAC name of (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine (CID 124671045) is (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine.
What is the SMILES notation for (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine?
The canonical SMILES for (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine is CC1(C)CNC[C@H]1c1ccccc1F.
What is the InChIKey of (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine?
The InChIKey is FLZGNBLMORKILV-JTQLQIEISA-N. The full InChI is InChI=1S/C12H16FN/c1-12(2)8-14-7-10(12)9-5-3-4-6-11(9)13/h3-6,10,14H,7-8H2,1-2H3/t10-/m0/s1.
What are the key properties of (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine?
(4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine has a molecular weight of 193.27 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(2-fluorophenyl)-3,3-dimethylpyrrolidine is sourced from PubChem (CID 124671045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).