C12H17FN2 — CID 82395314
6-(3-fluorophenyl)-2,2-dimethylpiperazine (PubChem CID 82395314) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-2,2-dimethylpiperazine.
| Compound Name | 6-(3-fluorophenyl)-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 82395314 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 6-(3-fluorophenyl)-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCC(c2cccc(F)c2)N1 |
| InChI | InChI=1S/C12H17FN2/c1-12(2)8-14-7-11(15-12)9-4-3-5-10(13)6-9/h3-6,11,14-15H,7-8H2,1-2H3 |
| InChIKey | VMIWCOJPJDNZNX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |