About 3-(3-fluorophenyl)azetidine;heptane;hydrochloride
3-(3-fluorophenyl)azetidine;heptane;hydrochloride (PubChem CID 175294675) has the molecular formula C16H27ClFN
and a molecular weight of 287.85 g/mol. Its IUPAC name is 3-(3-fluorophenyl)azetidine;heptane;hydrochloride.
Molecular Properties
| Compound Name | 3-(3-fluorophenyl)azetidine;heptane;hydrochloride |
| PubChem CID | 175294675 |
| Molecular Formula | C16H27ClFN |
| Molecular Weight | 287.85 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 3-(3-fluorophenyl)azetidine;heptane;hydrochloride |
| SMILES | CCCCCCC.Cl.Fc1cccc(C2CNC2)c1 |
| InChI | InChI=1S/C9H10FN.C7H16.ClH/c10-9-3-1-2-7(4-9)8-5-11-6-8;1-3-5-7-6-4-2;/h1-4,8,11H,5-6H2;3-7H2,1-2H3;1H |
| InChIKey | XKTJJUBWDMDQJP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-fluorophenyl)azetidine;heptane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorophenyl)azetidine;heptane;hydrochloride?
The IUPAC name of 3-(3-fluorophenyl)azetidine;heptane;hydrochloride (CID 175294675) is 3-(3-fluorophenyl)azetidine;heptane;hydrochloride.
What is the SMILES notation for 3-(3-fluorophenyl)azetidine;heptane;hydrochloride?
The canonical SMILES for 3-(3-fluorophenyl)azetidine;heptane;hydrochloride is CCCCCCC.Cl.Fc1cccc(C2CNC2)c1.
What is the InChIKey of 3-(3-fluorophenyl)azetidine;heptane;hydrochloride?
The InChIKey is XKTJJUBWDMDQJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN.C7H16.ClH/c10-9-3-1-2-7(4-9)8-5-11-6-8;1-3-5-7-6-4-2;/h1-4,8,11H,5-6H2;3-7H2,1-2H3;1H.
What are the key properties of 3-(3-fluorophenyl)azetidine;heptane;hydrochloride?
3-(3-fluorophenyl)azetidine;heptane;hydrochloride has a molecular weight of 287.85 g/mol, XLogP of 4.91, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorophenyl)azetidine;heptane;hydrochloride is sourced from PubChem (CID 175294675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).