C13H16FN — CID 84673420
8-(3-fluorophenyl)-3-azabicyclo[3.2.1]octane (PubChem CID 84673420) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is 8-(3-fluorophenyl)-3-azabicyclo[3.2.1]octane.
| Compound Name | 8-(3-fluorophenyl)-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 84673420 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 8-(3-fluorophenyl)-3-azabicyclo[3.2.1]octane |
| SMILES | Fc1cccc(C2C3CCC2CNC3)c1 |
| InChI | InChI=1S/C13H16FN/c14-12-3-1-2-9(6-12)13-10-4-5-11(13)8-15-7-10/h1-3,6,10-11,13,15H,4-5,7-8H2 |
| InChIKey | FPCGIRFWIFVBDY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |