C9H10FNO — CID 105433367
4-(3-fluorophenyl)-1,2-oxazolidine (PubChem CID 105433367) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1,2-oxazolidine.
| Compound Name | 4-(3-fluorophenyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 105433367 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 4-(3-fluorophenyl)-1,2-oxazolidine |
| SMILES | Fc1cccc(C2CNOC2)c1 |
| InChI | InChI=1S/C9H10FNO/c10-9-3-1-2-7(4-9)8-5-11-12-6-8/h1-4,8,11H,5-6H2 |
| InChIKey | DEXCZAZPRKLCRZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |