About 2-(3-fluorophenyl)-1,3-dithiane
2-(3-fluorophenyl)-1,3-dithiane (PubChem CID 71345753) has the molecular formula C10H11FS2
and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-1,3-dithiane |
| PubChem CID | 71345753 |
| Molecular Formula | C10H11FS2 |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 2-(3-fluorophenyl)-1,3-dithiane |
| SMILES | Fc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C10H11FS2/c11-9-4-1-3-8(7-9)10-12-5-2-6-13-10/h1,3-4,7,10H,2,5-6H2 |
| InChIKey | FFQFYDRRUQYEKL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-fluorophenyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-1,3-dithiane?
The IUPAC name of 2-(3-fluorophenyl)-1,3-dithiane (CID 71345753) is 2-(3-fluorophenyl)-1,3-dithiane.
What is the SMILES notation for 2-(3-fluorophenyl)-1,3-dithiane?
The canonical SMILES for 2-(3-fluorophenyl)-1,3-dithiane is Fc1cccc(C2SCCCS2)c1.
What is the InChIKey of 2-(3-fluorophenyl)-1,3-dithiane?
The InChIKey is FFQFYDRRUQYEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FS2/c11-9-4-1-3-8(7-9)10-12-5-2-6-13-10/h1,3-4,7,10H,2,5-6H2.
What are the key properties of 2-(3-fluorophenyl)-1,3-dithiane?
2-(3-fluorophenyl)-1,3-dithiane has a molecular weight of 214.33 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-1,3-dithiane is sourced from PubChem (CID 71345753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).