C11H13FS2 — CID 19793236
2-[(3-fluorophenyl)methyl]-1,3-dithiane (PubChem CID 19793236) has the molecular formula C11H13FS2 and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-1,3-dithiane.
| Compound Name | 2-[(3-fluorophenyl)methyl]-1,3-dithiane |
|---|---|
| PubChem CID | 19793236 |
| Molecular Formula | C11H13FS2 |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-1,3-dithiane |
| SMILES | Fc1cccc(CC2SCCCS2)c1 |
| InChI | InChI=1S/C11H13FS2/c12-10-4-1-3-9(7-10)8-11-13-5-2-6-14-11/h1,3-4,7,11H,2,5-6,8H2 |
| InChIKey | CSOCPTFRNFPNOG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |