C12H16FNS — CID 174785090
2-[(3-fluorophenyl)methyl]-4-methylthiomorpholine (PubChem CID 174785090) has the molecular formula C12H16FNS and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-4-methylthiomorpholine.
| Compound Name | 2-[(3-fluorophenyl)methyl]-4-methylthiomorpholine |
|---|---|
| PubChem CID | 174785090 |
| Molecular Formula | C12H16FNS |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-4-methylthiomorpholine |
| SMILES | CN1CCSC(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C12H16FNS/c1-14-5-6-15-12(9-14)8-10-3-2-4-11(13)7-10/h2-4,7,12H,5-6,8-9H2,1H3 |
| InChIKey | RXPCPWQLNZKLNE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |