C11H13BrFNO — CID 172689726
4-bromo-2-[(3-fluorophenyl)methyl]morpholine (PubChem CID 172689726) has the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. Its IUPAC name is 4-bromo-2-[(3-fluorophenyl)methyl]morpholine.
| Compound Name | 4-bromo-2-[(3-fluorophenyl)methyl]morpholine |
|---|---|
| PubChem CID | 172689726 |
| Molecular Formula | C11H13BrFNO |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 4-bromo-2-[(3-fluorophenyl)methyl]morpholine |
| SMILES | Fc1cccc(CC2CN(Br)CCO2)c1 |
| InChI | InChI=1S/C11H13BrFNO/c12-14-4-5-15-11(8-14)7-9-2-1-3-10(13)6-9/h1-3,6,11H,4-5,7-8H2 |
| InChIKey | BNBKNPYROGDTJP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|