C16H18F5NO3 — CID 95555442
1-[(2S)-2-[(3-fluorophenyl)methyl]morpholin-4-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone (PubChem CID 95555442) has the molecular formula C16H18F5NO3 and a molecular weight of 367.31 g/mol. Its IUPAC name is 1-[(2S)-2-[(3-fluorophenyl)methyl]morpholin-4-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone.
| Compound Name | 1-[(2S)-2-[(3-fluorophenyl)methyl]morpholin-4-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 95555442 |
| Molecular Formula | C16H18F5NO3 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-[(2S)-2-[(3-fluorophenyl)methyl]morpholin-4-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
| SMILES | O=C(COCC(F)(F)C(F)F)N1CCO[C@@H](Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H18F5NO3/c17-12-3-1-2-11(6-12)7-13-8-22(4-5-25-13)14(23)9-24-10-16(20,21)15(18)19/h1-3,6,13,15H,4-5,7-10H2/t13-/m0/s1 |
| InChIKey | PNENCNVCHCAFFB-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|