C20H23NO5 — CID 56864991
2-(2-hydroxyphenoxy)-1-[2-[(3-methoxyphenyl)methyl]morpholin-4-yl]ethanone (PubChem CID 56864991) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(2-hydroxyphenoxy)-1-[2-[(3-methoxyphenyl)methyl]morpholin-4-yl]ethanone.
| Compound Name | 2-(2-hydroxyphenoxy)-1-[2-[(3-methoxyphenyl)methyl]morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 56864991 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-(2-hydroxyphenoxy)-1-[2-[(3-methoxyphenyl)methyl]morpholin-4-yl]ethanone |
| SMILES | COc1cccc(CC2CN(C(=O)COc3ccccc3O)CCO2)c1 |
| InChI | InChI=1S/C20H23NO5/c1-24-16-6-4-5-15(11-16)12-17-13-21(9-10-25-17)20(23)14-26-19-8-3-2-7-18(19)22/h2-8,11,17,22H,9-10,12-14H2,1H3 |
| InChIKey | PQMLWBXFMLKEAC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |