C17H22N2O4 — CID 45197469
1-[2-[(3-methoxyphenyl)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide (PubChem CID 45197469) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-[2-[(3-methoxyphenyl)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[2-[(3-methoxyphenyl)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 45197469 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[2-[(3-methoxyphenyl)methyl]morpholine-4-carbonyl]cyclopropane-1-carboxamide |
| SMILES | COc1cccc(CC2CN(C(=O)C3(C(N)=O)CC3)CCO2)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-22-13-4-2-3-12(9-13)10-14-11-19(7-8-23-14)16(21)17(5-6-17)15(18)20/h2-4,9,14H,5-8,10-11H2,1H3,(H2,18,20) |
| InChIKey | GUVDQXMXVNSEDK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|