C17H18ClNO3S — CID 26322636
(3-chlorothiophen-2-yl)-[(2S)-2-[(3-methoxyphenyl)methyl]morpholin-4-yl]methanone (PubChem CID 26322636) has the molecular formula C17H18ClNO3S and a molecular weight of 351.86 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-[(2S)-2-[(3-methoxyphenyl)methyl]morpholin-4-yl]methanone.
| Compound Name | (3-chlorothiophen-2-yl)-[(2S)-2-[(3-methoxyphenyl)methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 26322636 |
| Molecular Formula | C17H18ClNO3S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (3-chlorothiophen-2-yl)-[(2S)-2-[(3-methoxyphenyl)methyl]morpholin-4-yl]methanone |
| SMILES | COc1cccc(C[C@H]2CN(C(=O)c3sccc3Cl)CCO2)c1 |
| InChI | InChI=1S/C17H18ClNO3S/c1-21-13-4-2-3-12(9-13)10-14-11-19(6-7-22-14)17(20)16-15(18)5-8-23-16/h2-5,8-9,14H,6-7,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | HCERKCDWASDCHF-AWEZNQCLSA-N |
| XLogP | 3.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |