C20H32FN3 — CID 75518320
1-[3-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]propyl]-4-methylpiperazine (PubChem CID 75518320) has the molecular formula C20H32FN3 and a molecular weight of 333.49 g/mol. Its IUPAC name is 1-[3-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]propyl]-4-methylpiperazine.
| Compound Name | 1-[3-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]propyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 75518320 |
| Molecular Formula | C20H32FN3 |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 1-[3-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]propyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCCN2CCC(Cc3cccc(F)c3)CC2)CC1 |
| InChI | InChI=1S/C20H32FN3/c1-22-12-14-24(15-13-22)9-3-8-23-10-6-18(7-11-23)16-19-4-2-5-20(21)17-19/h2,4-5,17-18H,3,6-16H2,1H3 |
| InChIKey | LZYVCRVTDAKRAN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |