C21H25FN2O — CID 60502457
2-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-N-methyl-N-phenylacetamide (PubChem CID 60502457) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is 2-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 60502457 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CN1CCC(Cc2cccc(F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H25FN2O/c1-23(20-8-3-2-4-9-20)21(25)16-24-12-10-17(11-13-24)14-18-6-5-7-19(22)15-18/h2-9,15,17H,10-14,16H2,1H3 |
| InChIKey | JQJLGHNFIHIABX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |