C16H16S2 — CID 15040193
2-(4-phenylphenyl)-1,3-dithiane (PubChem CID 15040193) has the molecular formula C16H16S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-1,3-dithiane.
| Compound Name | 2-(4-phenylphenyl)-1,3-dithiane |
|---|---|
| PubChem CID | 15040193 |
| Molecular Formula | C16H16S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(4-phenylphenyl)-1,3-dithiane |
| SMILES | c1ccc(-c2ccc(C3SCCCS3)cc2)cc1 |
| InChI | InChI=1S/C16H16S2/c1-2-5-13(6-3-1)14-7-9-15(10-8-14)16-17-11-4-12-18-16/h1-3,5-10,16H,4,11-12H2 |
| InChIKey | NNNDWNVTLKPUSU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |