C26H20O — CID 15400082
(2R,3R)-2,3-bis(4-phenylphenyl)oxirane (PubChem CID 15400082) has the molecular formula C26H20O and a molecular weight of 348.44 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(4-phenylphenyl)oxirane.
| Compound Name | (2R,3R)-2,3-bis(4-phenylphenyl)oxirane |
|---|---|
| PubChem CID | 15400082 |
| Molecular Formula | C26H20O |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2R,3R)-2,3-bis(4-phenylphenyl)oxirane |
| SMILES | c1ccc(-c2ccc([C@H]3O[C@@H]3c3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H20O/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-26(27-25)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18,25-26H/t25-,26-/m1/s1 |
| InChIKey | ICAZZOAIOYXVIA-CLJLJLNGSA-N |
| XLogP | 6.83 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|