C28H24O — CID 102288914
(2R,3S,4S,5R)-2,3,4,5-tetraphenyloxolane (PubChem CID 102288914) has the molecular formula C28H24O and a molecular weight of 376.50 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5-tetraphenyloxolane.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5-tetraphenyloxolane |
|---|---|
| PubChem CID | 102288914 |
| Molecular Formula | C28H24O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5-tetraphenyloxolane |
| SMILES | c1ccc([C@@H]2[C@@H](c3ccccc3)[C@H](c3ccccc3)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)29-27(25)23-17-9-3-10-18-23/h1-20,25-28H/t25-,26-,27+,28+/m1/s1 |
| InChIKey | DYNQJWJNBFPGRK-VIJSPRBVSA-N |
| XLogP | 7.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |