C15H13Br — CID 135038673
[(1S,3S)-2-bromo-3-phenylcyclopropyl]benzene (PubChem CID 135038673) has the molecular formula C15H13Br and a molecular weight of 273.17 g/mol. Its IUPAC name is [(1S,3S)-2-bromo-3-phenylcyclopropyl]benzene.
| Compound Name | [(1S,3S)-2-bromo-3-phenylcyclopropyl]benzene |
|---|---|
| PubChem CID | 135038673 |
| Molecular Formula | C15H13Br |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | [(1S,3S)-2-bromo-3-phenylcyclopropyl]benzene |
| SMILES | BrC1[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H13Br/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10,13-15H/t13-,14-/m1/s1 |
| InChIKey | SCDMCLGPCYOQMQ-ZIAGYGMSSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|