About difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane
difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane (PubChem CID 159362324) has the molecular formula C23H23F5S3
and a molecular weight of 490.63 g/mol. Its IUPAC name is difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane.
Molecular Properties
| Compound Name | difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane |
| PubChem CID | 159362324 |
| Molecular Formula | C23H23F5S3 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane |
| SMILES | FC(F)c1ccccc1.FS(F)(F)c1ccccc1.c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C10H12S2.C7H6F2.C6H5F3S/c1-2-5-9(6-3-1)10-11-7-4-8-12-10;8-7(9)6-4-2-1-3-5-6;7-10(8,9)6-4-2-1-3-5-6/h1-3,5-6,10H,4,7-8H2;1-5,7H;1-5H |
| InChIKey | LIRPWFGNJZAKGW-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane?
The IUPAC name of difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane (CID 159362324) is difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane.
What is the SMILES notation for difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane?
The canonical SMILES for difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane is FC(F)c1ccccc1.FS(F)(F)c1ccccc1.c1ccc(C2SCCCS2)cc1.
What is the InChIKey of difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane?
The InChIKey is LIRPWFGNJZAKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S2.C7H6F2.C6H5F3S/c1-2-5-9(6-3-1)10-11-7-4-8-12-10;8-7(9)6-4-2-1-3-5-6;7-10(8,9)6-4-2-1-3-5-6/h1-3,5-6,10H,4,7-8H2;1-5,7H;1-5H.
What are the key properties of difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane?
difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane has a molecular weight of 490.63 g/mol, XLogP of 9.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethylbenzene;2-phenyl-1,3-dithiane;trifluoro(phenyl)-λ4-sulfane is sourced from PubChem (CID 159362324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).