About difluoromethylbenzene;ethylcyclopropane
difluoromethylbenzene;ethylcyclopropane (PubChem CID 157034020) has the molecular formula C12H16F2
and a molecular weight of 198.26 g/mol. Its IUPAC name is difluoromethylbenzene;ethylcyclopropane.
Molecular Properties
| Compound Name | difluoromethylbenzene;ethylcyclopropane |
| PubChem CID | 157034020 |
| Molecular Formula | C12H16F2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | difluoromethylbenzene;ethylcyclopropane |
| SMILES | CCC1CC1.FC(F)c1ccccc1 |
| InChI | InChI=1S/C7H6F2.C5H10/c8-7(9)6-4-2-1-3-5-6;1-2-5-3-4-5/h1-5,7H;5H,2-4H2,1H3 |
| InChIKey | IGIPUXIJPYTKHQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze difluoromethylbenzene;ethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethylbenzene;ethylcyclopropane?
The IUPAC name of difluoromethylbenzene;ethylcyclopropane (CID 157034020) is difluoromethylbenzene;ethylcyclopropane.
What is the SMILES notation for difluoromethylbenzene;ethylcyclopropane?
The canonical SMILES for difluoromethylbenzene;ethylcyclopropane is CCC1CC1.FC(F)c1ccccc1.
What is the InChIKey of difluoromethylbenzene;ethylcyclopropane?
The InChIKey is IGIPUXIJPYTKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2.C5H10/c8-7(9)6-4-2-1-3-5-6;1-2-5-3-4-5/h1-5,7H;5H,2-4H2,1H3.
What are the key properties of difluoromethylbenzene;ethylcyclopropane?
difluoromethylbenzene;ethylcyclopropane has a molecular weight of 198.26 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethylbenzene;ethylcyclopropane is sourced from PubChem (CID 157034020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).