C18H20OS2 — CID 19989663
2-[4-(1-phenylethoxy)phenyl]-1,3-dithiane (PubChem CID 19989663) has the molecular formula C18H20OS2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 2-[4-(1-phenylethoxy)phenyl]-1,3-dithiane.
| Compound Name | 2-[4-(1-phenylethoxy)phenyl]-1,3-dithiane |
|---|---|
| PubChem CID | 19989663 |
| Molecular Formula | C18H20OS2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[4-(1-phenylethoxy)phenyl]-1,3-dithiane |
| SMILES | CC(Oc1ccc(C2SCCCS2)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H20OS2/c1-14(15-6-3-2-4-7-15)19-17-10-8-16(9-11-17)18-20-12-5-13-21-18/h2-4,6-11,14,18H,5,12-13H2,1H3 |
| InChIKey | ZYRPUHRXWDDWNN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |