C11H14OS2 — CID 11276210
2-(3-methoxyphenyl)-1,3-dithiane (PubChem CID 11276210) has the molecular formula C11H14OS2 and a molecular weight of 226.37 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1,3-dithiane.
| Compound Name | 2-(3-methoxyphenyl)-1,3-dithiane |
|---|---|
| PubChem CID | 11276210 |
| Molecular Formula | C11H14OS2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(3-methoxyphenyl)-1,3-dithiane |
| SMILES | COc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C11H14OS2/c1-12-10-5-2-4-9(8-10)11-13-6-3-7-14-11/h2,4-5,8,11H,3,6-7H2,1H3 |
| InChIKey | QZBJJXMITFWMSS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |