C10H12OS2 — CID 23175
2-(4-methoxyphenyl)-1,3-dithiolane (PubChem CID 23175) has the molecular formula C10H12OS2 and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1,3-dithiolane.
| Compound Name | 2-(4-methoxyphenyl)-1,3-dithiolane |
|---|---|
| PubChem CID | 23175 |
| Molecular Formula | C10H12OS2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-(4-methoxyphenyl)-1,3-dithiolane |
| SMILES | COc1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C10H12OS2/c1-11-9-4-2-8(3-5-9)10-12-6-7-13-10/h2-5,10H,6-7H2,1H3 |
| InChIKey | JYWZOJISGOBZDP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |