C13H16NOS2+ — CID 135059774
1-[4-(4-methoxyphenyl)-1,3-dithietan-2-ylidene]pyrrolidin-1-ium (PubChem CID 135059774) has the molecular formula C13H16NOS2+ and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,3-dithietan-2-ylidene]pyrrolidin-1-ium.
| Compound Name | 1-[4-(4-methoxyphenyl)-1,3-dithietan-2-ylidene]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 135059774 |
| Molecular Formula | C13H16NOS2+ |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,3-dithietan-2-ylidene]pyrrolidin-1-ium |
| SMILES | COc1ccc(C2SC(=[N+]3CCCC3)S2)cc1 |
| InChI | InChI=1S/C13H16NOS2/c1-15-11-6-4-10(5-7-11)12-16-13(17-12)14-8-2-3-9-14/h4-7,12H,2-3,8-9H2,1H3/q+1 |
| InChIKey | FVHAMIMIQZHILJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|