C12H13F3OS — CID 135044364
(2R,3S)-2-(4-methoxyphenyl)-3-(trifluoromethyl)thiolane (PubChem CID 135044364) has the molecular formula C12H13F3OS and a molecular weight of 262.30 g/mol. Its IUPAC name is (2R,3S)-2-(4-methoxyphenyl)-3-(trifluoromethyl)thiolane.
| Compound Name | (2R,3S)-2-(4-methoxyphenyl)-3-(trifluoromethyl)thiolane |
|---|---|
| PubChem CID | 135044364 |
| Molecular Formula | C12H13F3OS |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (2R,3S)-2-(4-methoxyphenyl)-3-(trifluoromethyl)thiolane |
| SMILES | COc1ccc([C@@H]2SCC[C@H]2C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3OS/c1-16-9-4-2-8(3-5-9)11-10(6-7-17-11)12(13,14)15/h2-5,10-11H,6-7H2,1H3/t10-,11+/m1/s1 |
| InChIKey | HHXYVKODCTYOLE-MNOVXSKESA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |