C12H13NO — CID 172635786
2-(4-methoxyphenyl)cyclobutane-1-carbonitrile (PubChem CID 172635786) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)cyclobutane-1-carbonitrile.
| Compound Name | 2-(4-methoxyphenyl)cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 172635786 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-(4-methoxyphenyl)cyclobutane-1-carbonitrile |
| SMILES | COc1ccc(C2CCC2C#N)cc1 |
| InChI | InChI=1S/C12H13NO/c1-14-11-5-2-9(3-6-11)12-7-4-10(12)8-13/h2-3,5-6,10,12H,4,7H2,1H3 |
| InChIKey | XOMOPMQWSCATBG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |