C16H17NO — CID 10752503
(1S,2R,3S,4R)-3-(4-methoxyphenyl)bicyclo[2.2.2]oct-5-ene-2-carbonitrile (PubChem CID 10752503) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-(4-methoxyphenyl)bicyclo[2.2.2]oct-5-ene-2-carbonitrile.
| Compound Name | (1S,2R,3S,4R)-3-(4-methoxyphenyl)bicyclo[2.2.2]oct-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 10752503 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1S,2R,3S,4R)-3-(4-methoxyphenyl)bicyclo[2.2.2]oct-5-ene-2-carbonitrile |
| SMILES | COc1ccc([C@@H]2[C@H](C#N)[C@@H]3C=C[C@H]2CC3)cc1 |
| InChI | InChI=1S/C16H17NO/c1-18-14-8-6-13(7-9-14)16-12-4-2-11(3-5-12)15(16)10-17/h2,4,6-9,11-12,15-16H,3,5H2,1H3/t11-,12+,15-,16-/m1/s1 |
| InChIKey | IJWWBFPZQODAEC-NOXHYTERSA-N |
| XLogP | 3.51 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|