C15H16O2 — CID 102575898
(1S,2R,3R,4R)-3-(4-methoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carbaldehyde (PubChem CID 102575898) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-(4-methoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carbaldehyde.
| Compound Name | (1S,2R,3R,4R)-3-(4-methoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 102575898 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1S,2R,3R,4R)-3-(4-methoxyphenyl)bicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
| SMILES | COc1ccc([C@H]2[C@H](C=O)[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C15H16O2/c1-17-13-6-4-10(5-7-13)15-12-3-2-11(8-12)14(15)9-16/h2-7,9,11-12,14-15H,8H2,1H3/t11-,12+,14-,15-/m1/s1 |
| InChIKey | DWUMUIUDTJWVEG-AYRXBEOTSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|