C9H10O2 — CID 152840581
(2S,3R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbaldehyde (PubChem CID 152840581) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is (2S,3R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbaldehyde.
| Compound Name | (2S,3R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbaldehyde |
|---|---|
| PubChem CID | 152840581 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (2S,3R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbaldehyde |
| SMILES | O=C[C@@H]1C2C=CC(C2)[C@@H]1C=O |
| InChI | InChI=1S/C9H10O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,4-9H,3H2/t6?,7?,8-,9+ |
| InChIKey | UYNITBWLFPWZLE-WZENYGAOSA-N |
| XLogP | 0.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|