C25H32O3 — CID 101198517
[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2S,3S,4S)-3-(4-methoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]methanone (PubChem CID 101198517) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2S,3S,4S)-3-(4-methoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]methanone.
| Compound Name | [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2S,3S,4S)-3-(4-methoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]methanone |
|---|---|
| PubChem CID | 101198517 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2S,3S,4S)-3-(4-methoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]methanone |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)[C@@]3(O)C[C@H]4CC[C@]3(C)C4(C)C)[C@H]3C=C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C25H32O3/c1-23(2)18-11-12-24(23,3)25(27,14-18)22(26)21-17-6-5-16(13-17)20(21)15-7-9-19(28-4)10-8-15/h5-10,16-18,20-21,27H,11-14H2,1-4H3/t16-,17+,18-,20+,21+,24-,25+/m1/s1 |
| InChIKey | BTCPEXVUZXOMGY-WXHWOBHYSA-N |
| XLogP | 4.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|